C30H37Cl3N2O4 — CID 6706732
2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6706732) has the molecular formula C30H37Cl3N2O4 and a molecular weight of 596.00 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6706732 |
| Molecular Formula | C30H37Cl3N2O4 |
| Molecular Weight | 596.00 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | 2,2,2-trichloro-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(NC(=O)C(Cl)(Cl)Cl)cc3)O2)C1 |
| InChI | InChI=1S/C30H37Cl3N2O4/c1-28(2)13-23-14-29(3,17-28)18-35(23)15-24-12-25(20-6-4-19(16-36)5-7-20)39-26(38-24)21-8-10-22(11-9-21)34-27(37)30(31,32)33/h4-11,23-26,36H,12-18H2,1-3H3,(H,34,37)/t23?,24-,25+,26+,29?/m0/s1 |
| InChIKey | LLYQUVSSXFTFQO-NERBRTLBSA-N |
| XLogP | 6.93 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.00 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|