C36H51N3O6 — CID 4020535
N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide (PubChem CID 4020535) has the molecular formula C36H51N3O6 and a molecular weight of 621.82 g/mol. Its IUPAC name is N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide.
| Compound Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
|---|---|
| PubChem CID | 4020535 |
| Molecular Formula | C36H51N3O6 |
| Molecular Weight | 621.82 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | N'-hydroxy-N-[4-[4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]octanediamide |
| SMILES | CC1(C)CC2CC(C)(CN2CC2CC(c3ccc(CO)cc3)OC(c3ccc(NC(=O)CCCCCCC(=O)NO)cc3)O2)C1 |
| InChI | InChI=1S/C36H51N3O6/c1-35(2)19-29-20-36(3,23-35)24-39(29)21-30-18-31(26-12-10-25(22-40)11-13-26)45-34(44-30)27-14-16-28(17-15-27)37-32(41)8-6-4-5-7-9-33(42)38-43/h10-17,29-31,34,40,43H,4-9,18-24H2,1-3H3,(H,37,41)(H,38,42) |
| InChIKey | ALKNASHPZPSOMO-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.82 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|