C35H49N3O6 — CID 6674061
N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide (PubChem CID 6674061) has the molecular formula C35H49N3O6 and a molecular weight of 607.79 g/mol. Its IUPAC name is N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide.
| Compound Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
|---|---|
| PubChem CID | 6674061 |
| Molecular Formula | C35H49N3O6 |
| Molecular Weight | 607.79 g/mol |
| Exact Mass | 607.36 |
| IUPAC Name | N'-hydroxy-N-[3-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]heptanediamide |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3cccc(NC(=O)CCCCCC(=O)NO)c3)O2)C1 |
| InChI | InChI=1S/C35H49N3O6/c1-34(2)18-28-19-35(3,22-34)23-38(28)20-29-17-30(25-14-12-24(21-39)13-15-25)44-33(43-29)26-8-7-9-27(16-26)36-31(40)10-5-4-6-11-32(41)37-42/h7-9,12-16,28-30,33,39,42H,4-6,10-11,17-23H2,1-3H3,(H,36,40)(H,37,41)/t28?,29-,30+,33+,35?/m1/s1 |
| InChIKey | KEJVEPQXDRNVAS-LEXPADGJSA-N |
| XLogP | 6.02 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.79 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|