C34H46N2O6 — CID 6677657
6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid (PubChem CID 6677657) has the molecular formula C34H46N2O6 and a molecular weight of 578.75 g/mol. Its IUPAC name is 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid.
| Compound Name | 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 6677657 |
| Molecular Formula | C34H46N2O6 |
| Molecular Weight | 578.75 g/mol |
| Exact Mass | 578.34 |
| IUPAC Name | 6-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]anilino]-6-oxohexanoic acid |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3cccc(NC(=O)CCCCC(=O)O)c3)O2)C1 |
| InChI | InChI=1S/C34H46N2O6/c1-33(2)17-27-18-34(3,21-33)22-36(27)19-28-16-29(24-13-11-23(20-37)12-14-24)42-32(41-28)25-7-6-8-26(15-25)35-30(38)9-4-5-10-31(39)40/h6-8,11-15,27-29,32,37H,4-5,9-10,16-22H2,1-3H3,(H,35,38)(H,39,40)/t27?,28-,29+,32+,34?/m0/s1 |
| InChIKey | VYBMCPHRDBSJHN-HRCHDTODSA-N |
| XLogP | 6.21 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.75 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|