C39H48N2O6 — CID 6695862
4-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid (PubChem CID 6695862) has the molecular formula C39H48N2O6 and a molecular weight of 640.82 g/mol. Its IUPAC name is 4-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6695862 |
| Molecular Formula | C39H48N2O6 |
| Molecular Weight | 640.82 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 4-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-4-oxobutanoic acid |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3cccc(-c4cccc(CNC(=O)CCC(=O)O)c4)c3)O2)C1 |
| InChI | InChI=1S/C39H48N2O6/c1-38(2)19-32-20-39(3,24-38)25-41(32)22-33-18-34(28-12-10-26(23-42)11-13-28)47-37(46-33)31-9-5-8-30(17-31)29-7-4-6-27(16-29)21-40-35(43)14-15-36(44)45/h4-13,16-17,32-34,37,42H,14-15,18-25H2,1-3H3,(H,40,43)(H,44,45)/t32?,33-,34+,37+,39?/m0/s1 |
| InChIKey | ZDWFJPIPNYHECY-LKSPUTPTSA-N |
| XLogP | 6.77 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.82 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |