C41H48N2O5S — CID 6695855
N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide (PubChem CID 6695855) has the molecular formula C41H48N2O5S and a molecular weight of 680.91 g/mol. Its IUPAC name is N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide.
| Compound Name | N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 6695855 |
| Molecular Formula | C41H48N2O5S |
| Molecular Weight | 680.91 g/mol |
| Exact Mass | 680.33 |
| IUPAC Name | N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]benzenesulfonamide |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3cccc(-c4cccc(CNS(=O)(=O)c5ccccc5)c4)c3)O2)C1 |
| InChI | InChI=1S/C41H48N2O5S/c1-40(2)22-35-23-41(3,27-40)28-43(35)25-36-21-38(31-17-15-29(26-44)16-18-31)48-39(47-36)34-12-8-11-33(20-34)32-10-7-9-30(19-32)24-42-49(45,46)37-13-5-4-6-14-37/h4-20,35-36,38-39,42,44H,21-28H2,1-3H3/t35?,36-,38+,39+,41?/m0/s1 |
| InChIKey | QKHWMGWGEUCIEW-JTIIYILISA-N |
| XLogP | 7.77 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.91 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |