C39H48N2O5 — CID 6695851
prop-2-enyl N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate (PubChem CID 6695851) has the molecular formula C39H48N2O5 and a molecular weight of 624.82 g/mol. Its IUPAC name is prop-2-enyl N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate.
| Compound Name | prop-2-enyl N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 6695851 |
| Molecular Formula | C39H48N2O5 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.36 |
| IUPAC Name | prop-2-enyl N-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]carbamate |
| SMILES | C=CCOC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CC5(C)CC4CC(C)(C)C5)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C39H48N2O5/c1-5-16-44-37(43)40-22-28-8-6-9-30(17-28)31-10-7-11-32(18-31)36-45-34(19-35(46-36)29-14-12-27(24-42)13-15-29)23-41-26-39(4)21-33(41)20-38(2,3)25-39/h5-15,17-18,33-36,42H,1,16,19-26H2,2-4H3,(H,40,43)/t33?,34-,35+,36+,39?/m0/s1 |
| InChIKey | VYGLYJVPVZYYHS-RVSRCKCGSA-N |
| XLogP | 7.70 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|