C40H50N2O6 — CID 6674090
5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid (PubChem CID 6674090) has the molecular formula C40H50N2O6 and a molecular weight of 654.85 g/mol. Its IUPAC name is 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 6674090 |
| Molecular Formula | C40H50N2O6 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.37 |
| IUPAC Name | 5-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methylamino]-5-oxopentanoic acid |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(-c4cccc(CNC(=O)CCCC(=O)O)c4)cc3)O2)C1 |
| InChI | InChI=1S/C40H50N2O6/c1-39(2)20-33-21-40(3,25-39)26-42(33)23-34-19-35(30-12-10-27(24-43)11-13-30)48-38(47-34)31-16-14-29(15-17-31)32-7-4-6-28(18-32)22-41-36(44)8-5-9-37(45)46/h4,6-7,10-18,33-35,38,43H,5,8-9,19-26H2,1-3H3,(H,41,44)(H,45,46)/t33?,34-,35+,38+,40?/m1/s1 |
| InChIKey | AXIABTPTJCTLIK-QBWPMFFRSA-N |
| XLogP | 7.16 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |