C43H46N2O5 — CID 6701313
2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6701313) has the molecular formula C43H46N2O5 and a molecular weight of 670.85 g/mol. Its IUPAC name is 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6701313 |
| Molecular Formula | C43H46N2O5 |
| Molecular Weight | 670.85 g/mol |
| Exact Mass | 670.34 |
| IUPAC Name | 2-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@H]2C[C@@H](c3ccc(CO)cc3)O[C@@H](c3ccc(-c4cccc(CN5C(=O)c6ccccc6C5=O)c4)cc3)O2)C1 |
| InChI | InChI=1S/C43H46N2O5/c1-42(2)21-34-22-43(3,26-42)27-44(34)24-35-20-38(31-13-11-28(25-46)12-14-31)50-41(49-35)32-17-15-30(16-18-32)33-8-6-7-29(19-33)23-45-39(47)36-9-4-5-10-37(36)40(45)48/h4-19,34-35,38,41,46H,20-27H2,1-3H3/t34?,35-,38+,41+,43?/m1/s1 |
| InChIKey | YUELNPQSZRWVER-CAKRQFEASA-N |
| XLogP | 8.09 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.85 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|