C38H49N3O4 — CID 6695866
1-ethyl-3-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea (PubChem CID 6695866) has the molecular formula C38H49N3O4 and a molecular weight of 611.83 g/mol. Its IUPAC name is 1-ethyl-3-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea.
| Compound Name | 1-ethyl-3-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 6695866 |
| Molecular Formula | C38H49N3O4 |
| Molecular Weight | 611.83 g/mol |
| Exact Mass | 611.37 |
| IUPAC Name | 1-ethyl-3-[[3-[3-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]urea |
| SMILES | CCNC(=O)NCc1cccc(-c2cccc([C@@H]3O[C@H](CN4CC5(C)CC4CC(C)(C)C5)C[C@H](c4ccc(CO)cc4)O3)c2)c1 |
| InChI | InChI=1S/C38H49N3O4/c1-5-39-36(43)40-21-27-8-6-9-29(16-27)30-10-7-11-31(17-30)35-44-33(18-34(45-35)28-14-12-26(23-42)13-15-28)22-41-25-38(4)20-32(41)19-37(2,3)24-38/h6-17,32-35,42H,5,18-25H2,1-4H3,(H2,39,40,43)/t32?,33-,34+,35+,38?/m0/s1 |
| InChIKey | WKDYKDADRBIIHI-ZOQJBSMMSA-N |
| XLogP | 7.11 |
| TPSA | 83.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.83 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |