C37H46N2O4 — CID 6701311
N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide (PubChem CID 6701311) has the molecular formula C37H46N2O4 and a molecular weight of 582.79 g/mol. Its IUPAC name is N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide.
| Compound Name | N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6701311 |
| Molecular Formula | C37H46N2O4 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.35 |
| IUPAC Name | N-[[3-[4-[(2R,4S,6R)-4-[4-(hydroxymethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]acetamide |
| SMILES | CC(=O)NCc1cccc(-c2ccc([C@H]3O[C@@H](CN4CC5(C)CC4CC(C)(C)C5)C[C@@H](c4ccc(CO)cc4)O3)cc2)c1 |
| InChI | InChI=1S/C37H46N2O4/c1-25(41)38-20-27-6-5-7-31(16-27)28-12-14-30(15-13-28)35-42-33(17-34(43-35)29-10-8-26(22-40)9-11-29)21-39-24-37(4)19-32(39)18-36(2,3)23-37/h5-16,32-35,40H,17-24H2,1-4H3,(H,38,41)/t32?,33-,34+,35+,37?/m1/s1 |
| InChIKey | IEPXAFYESBRNNK-WRVDWXMVSA-N |
| XLogP | 6.93 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |