C29H40N2O3 — CID 6695784
[4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-4-yl]phenyl]methanol (PubChem CID 6695784) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-4-yl]phenyl]methanol.
| Compound Name | [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-4-yl]phenyl]methanol |
|---|---|
| PubChem CID | 6695784 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | [4-[(2S,4R,6S)-2-[4-(aminomethyl)phenyl]-6-[(1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl)methyl]-1,3-dioxan-4-yl]phenyl]methanol |
| SMILES | CC1(C)CC2CC(C)(CN2C[C@@H]2C[C@H](c3ccc(CO)cc3)O[C@H](c3ccc(CN)cc3)O2)C1 |
| InChI | InChI=1S/C29H40N2O3/c1-28(2)13-24-14-29(3,18-28)19-31(24)16-25-12-26(22-8-6-21(17-32)7-9-22)34-27(33-25)23-10-4-20(15-30)5-11-23/h4-11,24-27,32H,12-19,30H2,1-3H3/t24?,25-,26+,27+,29?/m0/s1 |
| InChIKey | YWBAZAUSHOKZFP-YFBHBLMNSA-N |
| XLogP | 5.08 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |