C27H24Cl3N3O4 — CID 4520125
N-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide (PubChem CID 4520125) has the molecular formula C27H24Cl3N3O4 and a molecular weight of 560.87 g/mol. Its IUPAC name is N-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide.
| Compound Name | N-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 4520125 |
| Molecular Formula | C27H24Cl3N3O4 |
| Molecular Weight | 560.87 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | N-[3-[4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]-2,2,2-trichloroacetamide |
| SMILES | O=C(Nc1cccc(C2OC(Cn3cnc4ccccc43)CC(c3ccc(CO)cc3)O2)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C27H24Cl3N3O4/c28-27(29,30)26(35)32-20-5-3-4-19(12-20)25-36-21(14-33-16-31-22-6-1-2-7-23(22)33)13-24(37-25)18-10-8-17(15-34)9-11-18/h1-12,16,21,24-25,34H,13-15H2,(H,32,35) |
| InChIKey | CYGBIEOXTLKNMI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.87 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|