C36H53Cl3N2O4 — CID 6703788
2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide (PubChem CID 6703788) has the molecular formula C36H53Cl3N2O4 and a molecular weight of 684.19 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 6703788 |
| Molecular Formula | C36H53Cl3N2O4 |
| Molecular Weight | 684.19 g/mol |
| Exact Mass | 682.31 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[(2R,4R,6S)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]acetamide |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@H]1C[C@@H](c2ccc(CO)cc2)O[C@@H](c2cccc(NC(=O)C(Cl)(Cl)Cl)c2)O1 |
| InChI | InChI=1S/C36H53Cl3N2O4/c1-3-5-7-9-11-13-22-41(23-14-12-10-8-6-4-2)26-32-25-33(29-20-18-28(27-42)19-21-29)45-34(44-32)30-16-15-17-31(24-30)40-35(43)36(37,38)39/h15-21,24,32-34,42H,3-14,22-23,25-27H2,1-2H3,(H,40,43)/t32-,33+,34+/m1/s1 |
| InChIKey | OLFDKVURKREMNJ-WKNISULPSA-N |
| XLogP | 10.06 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.19 |
| LogP ≤ 5 | 10.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|