C45H65N3O6 — CID 6698308
methyl (2S)-2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate (PubChem CID 6698308) has the molecular formula C45H65N3O6 and a molecular weight of 744.03 g/mol. Its IUPAC name is methyl (2S)-2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6698308 |
| Molecular Formula | C45H65N3O6 |
| Molecular Weight | 744.03 g/mol |
| Exact Mass | 743.49 |
| IUPAC Name | methyl (2S)-2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]-3-phenylpropanoate |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)N[C@@H](Cc3ccccc3)C(=O)OC)c2)O1 |
| InChI | InChI=1S/C45H65N3O6/c1-4-6-8-10-12-17-28-48(29-18-13-11-9-7-5-2)33-40-32-42(37-26-24-36(34-49)25-27-37)54-44(53-40)38-22-19-23-39(31-38)46-45(51)47-41(43(50)52-3)30-35-20-15-14-16-21-35/h14-16,19-27,31,40-42,44,49H,4-13,17-18,28-30,32-34H2,1-3H3,(H2,46,47,51)/t40-,41-,42+,44+/m0/s1 |
| InChIKey | IMJYYZLIZMDLND-QMXSQFLOSA-N |
| XLogP | 9.65 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.03 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|