C39H60N2O6 — CID 3508467
[1-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate (PubChem CID 3508467) has the molecular formula C39H60N2O6 and a molecular weight of 652.92 g/mol. Its IUPAC name is [1-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate.
| Compound Name | [1-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
|---|---|
| PubChem CID | 3508467 |
| Molecular Formula | C39H60N2O6 |
| Molecular Weight | 652.92 g/mol |
| Exact Mass | 652.45 |
| IUPAC Name | [1-[3-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]anilino]-1-oxopropan-2-yl] acetate |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)C(C)OC(C)=O)c2)O1 |
| InChI | InChI=1S/C39H60N2O6/c1-5-7-9-11-13-15-24-41(25-16-14-12-10-8-6-2)28-36-27-37(33-22-20-32(29-42)21-23-33)47-39(46-36)34-18-17-19-35(26-34)40-38(44)30(3)45-31(4)43/h17-23,26,30,36-37,39,42H,5-16,24-25,27-29H2,1-4H3,(H,40,44) |
| InChIKey | IICFBWIWIUKRIK-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.92 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|