C39H61N3O6 — CID 6698307
ethyl 2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6698307) has the molecular formula C39H61N3O6 and a molecular weight of 667.93 g/mol. Its IUPAC name is ethyl 2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6698307 |
| Molecular Formula | C39H61N3O6 |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.46 |
| IUPAC Name | ethyl 2-[[3-[(2S,4S,6R)-4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCCCCCCCN(CCCCCCCC)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2cccc(NC(=O)NCC(=O)OCC)c2)O1 |
| InChI | InChI=1S/C39H61N3O6/c1-4-7-9-11-13-15-24-42(25-16-14-12-10-8-5-2)29-35-27-36(32-22-20-31(30-43)21-23-32)48-38(47-35)33-18-17-19-34(26-33)41-39(45)40-28-37(44)46-6-3/h17-23,26,35-36,38,43H,4-16,24-25,27-30H2,1-3H3,(H2,40,41,45)/t35-,36+,38+/m0/s1 |
| InChIKey | FFONPJRBGUCNIV-QOZRZDGHSA-N |
| XLogP | 8.43 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|