C33H33F3N4O5 — CID 6705442
(2S)-N-[4-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 6705442) has the molecular formula C33H33F3N4O5 and a molecular weight of 622.64 g/mol. Its IUPAC name is (2S)-N-[4-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 6705442 |
| Molecular Formula | C33H33F3N4O5 |
| Molecular Weight | 622.64 g/mol |
| Exact Mass | 622.24 |
| IUPAC Name | (2S)-N-[4-[(2R,4R,5S,6S)-4-(benzimidazol-1-ylmethyl)-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | C[C@@H]1[C@H](Cn2cnc3ccccc32)O[C@H](c2ccc(NC(=O)[C@@H]3CCCN3C(=O)C(F)(F)F)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C33H33F3N4O5/c1-20-28(17-39-19-37-25-5-2-3-6-26(25)39)44-31(45-29(20)22-10-8-21(18-41)9-11-22)23-12-14-24(15-13-23)38-30(42)27-7-4-16-40(27)32(43)33(34,35)36/h2-3,5-6,8-15,19-20,27-29,31,41H,4,7,16-18H2,1H3,(H,38,42)/t20-,27+,28+,29+,31+/m1/s1 |
| InChIKey | CCLCHMQZEQOKCE-JIMVDFFJSA-N |
| XLogP | 5.51 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.64 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |