C31H34N2O8S — CID 6704639
4-[[(2S,4S,5R,6R)-2-[4-[(2-ethoxy-2-oxoethyl)carbamoylamino]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6704639) has the molecular formula C31H34N2O8S and a molecular weight of 594.69 g/mol. Its IUPAC name is 4-[[(2S,4S,5R,6R)-2-[4-[(2-ethoxy-2-oxoethyl)carbamoylamino]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 4-[[(2S,4S,5R,6R)-2-[4-[(2-ethoxy-2-oxoethyl)carbamoylamino]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6704639 |
| Molecular Formula | C31H34N2O8S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 4-[[(2S,4S,5R,6R)-2-[4-[(2-ethoxy-2-oxoethyl)carbamoylamino]phenyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccc(C(=O)O)cc3)O2)cc1 |
| InChI | InChI=1S/C31H34N2O8S/c1-3-39-27(35)16-32-31(38)33-24-12-8-23(9-13-24)30-40-26(18-42-25-14-10-22(11-15-25)29(36)37)19(2)28(41-30)21-6-4-20(17-34)5-7-21/h4-15,19,26,28,30,34H,3,16-18H2,1-2H3,(H,36,37)(H2,32,33,38)/t19-,26+,28?,30+/m0/s1 |
| InChIKey | GGSYJSWWVHGDQX-CNWYOHGUSA-N |
| XLogP | 5.15 |
| TPSA | 143.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |