C27H33N5O6S — CID 6705387
ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6705387) has the molecular formula C27H33N5O6S and a molecular weight of 555.66 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6705387 |
| Molecular Formula | C27H33N5O6S |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | ethyl 2-[[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@@H]2OC(c3ccc(CO)cc3)[C@H](C)[C@H](CSc3nncn3C)O2)cc1 |
| InChI | InChI=1S/C27H33N5O6S/c1-4-36-23(34)13-28-26(35)30-21-11-9-20(10-12-21)25-37-22(15-39-27-31-29-16-32(27)3)17(2)24(38-25)19-7-5-18(14-33)6-8-19/h5-12,16-17,22,24-25,33H,4,13-15H2,1-3H3,(H2,28,30,35)/t17-,22+,24?,25+/m1/s1 |
| InChIKey | YYSJSTQPIKLKHF-LVUUHUFRSA-N |
| XLogP | 3.58 |
| TPSA | 136.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |