C32H37N3O7S — CID 6704771
ethyl 2-[[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate (PubChem CID 6704771) has the molecular formula C32H37N3O7S and a molecular weight of 607.73 g/mol. Its IUPAC name is ethyl 2-[[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate.
| Compound Name | ethyl 2-[[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
|---|---|
| PubChem CID | 6704771 |
| Molecular Formula | C32H37N3O7S |
| Molecular Weight | 607.73 g/mol |
| Exact Mass | 607.24 |
| IUPAC Name | ethyl 2-[[4-[(2S,4S,5R,6R)-4-[(4-acetamidophenyl)sulfanylmethyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]carbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)Nc1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccc(NC(C)=O)cc3)O2)cc1 |
| InChI | InChI=1S/C32H37N3O7S/c1-4-40-29(38)17-33-32(39)35-26-11-9-24(10-12-26)31-41-28(19-43-27-15-13-25(14-16-27)34-21(3)37)20(2)30(42-31)23-7-5-22(18-36)6-8-23/h5-16,20,28,30-31,36H,4,17-19H2,1-3H3,(H,34,37)(H2,33,35,39)/t20-,28+,30?,31+/m0/s1 |
| InChIKey | IAXBHOMMWCCOCL-NGWZHNBQSA-N |
| XLogP | 5.41 |
| TPSA | 135.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.73 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |