C42H41N3O5 — CID 6689854
2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione (PubChem CID 6689854) has the molecular formula C42H41N3O5 and a molecular weight of 667.81 g/mol. Its IUPAC name is 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6689854 |
| Molecular Formula | C42H41N3O5 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | 2-[[3-[4-[(2R,4S,5S,6R)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-[[methyl(2-pyridin-2-ylethyl)amino]methyl]-1,3-dioxan-2-yl]phenyl]phenyl]methyl]isoindole-1,3-dione |
| SMILES | C[C@@H]1[C@H](CN(C)CCc2ccccn2)O[C@H](c2ccc(-c3cccc(CN4C(=O)c5ccccc5C4=O)c3)cc2)O[C@@H]1c1ccc(CO)cc1 |
| InChI | InChI=1S/C42H41N3O5/c1-28-38(26-44(2)23-21-35-10-5-6-22-43-35)49-42(50-39(28)32-15-13-29(27-46)14-16-32)33-19-17-31(18-20-33)34-9-7-8-30(24-34)25-45-40(47)36-11-3-4-12-37(36)41(45)48/h3-20,22,24,28,38-39,42,46H,21,23,25-27H2,1-2H3/t28-,38+,39+,42+/m1/s1 |
| InChIKey | ALBMWBAKDBJGTQ-HXDYTEBPSA-N |
| XLogP | 7.00 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|