C54H71N3O7 — CID 3542956
benzyl N-[1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 3542956) has the molecular formula C54H71N3O7 and a molecular weight of 874.18 g/mol. Its IUPAC name is benzyl N-[1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 3542956 |
| Molecular Formula | C54H71N3O7 |
| Molecular Weight | 874.18 g/mol |
| Exact Mass | 873.53 |
| IUPAC Name | benzyl N-[1-[[3-[4-[4-[(dioctylamino)methyl]-6-[4-(hydroxymethyl)phenyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | CCCCCCCCN(CCCCCCCC)CC1OC(c2ccc(-c3cccc(CN4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)c3)cc2)OC(c2ccc(CO)cc2)C1C |
| InChI | InChI=1S/C54H71N3O7/c1-4-6-8-10-12-17-32-56(33-18-13-11-9-7-5-2)37-49-40(3)51(45-26-24-41(38-58)25-27-45)64-53(63-49)46-30-28-44(29-31-46)47-23-19-22-43(34-47)36-57-50(59)35-48(52(57)60)55-54(61)62-39-42-20-15-14-16-21-42/h14-16,19-31,34,40,48-49,51,53,58H,4-13,17-18,32-33,35-39H2,1-3H3,(H,55,61) |
| InChIKey | QSXFMEOMIQHIBG-UHFFFAOYSA-N |
| XLogP | 11.21 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.18 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|