C43H41N3O7S — CID 6682504
benzyl N-[1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate (PubChem CID 6682504) has the molecular formula C43H41N3O7S and a molecular weight of 743.88 g/mol. Its IUPAC name is benzyl N-[1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate.
| Compound Name | benzyl N-[1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 6682504 |
| Molecular Formula | C43H41N3O7S |
| Molecular Weight | 743.88 g/mol |
| Exact Mass | 743.27 |
| IUPAC Name | benzyl N-[1-[[3-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-5-methyl-6-(pyridin-2-ylsulfanylmethyl)-1,3-dioxan-2-yl]phenyl]phenyl]methyl]-2,5-dioxopyrrolidin-3-yl]carbamate |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3cccc(CN4C(=O)CC(NC(=O)OCc5ccccc5)C4=O)c3)cc2)O[C@@H]1CSc1ccccn1 |
| InChI | InChI=1S/C43H41N3O7S/c1-28-37(27-54-38-12-5-6-21-44-38)52-42(53-40(28)33-15-13-29(25-47)14-16-33)34-19-17-32(18-20-34)35-11-7-10-31(22-35)24-46-39(48)23-36(41(46)49)45-43(50)51-26-30-8-3-2-4-9-30/h2-22,28,36-37,40,42,47H,23-27H2,1H3,(H,45,50)/t28-,36?,37+,40?,42+/m0/s1 |
| InChIKey | FOXFLFWIFDFDFM-QHKSXHIGSA-N |
| XLogP | 7.38 |
| TPSA | 127.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.88 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|