C36H47N3O6 — CID 6706871
6-acetamido-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanamide (PubChem CID 6706871) has the molecular formula C36H47N3O6 and a molecular weight of 617.79 g/mol. Its IUPAC name is 6-acetamido-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanamide.
| Compound Name | 6-acetamido-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
|---|---|
| PubChem CID | 6706871 |
| Molecular Formula | C36H47N3O6 |
| Molecular Weight | 617.79 g/mol |
| Exact Mass | 617.35 |
| IUPAC Name | 6-acetamido-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]hexanamide |
| SMILES | CC(=O)NCCCCCC(=O)Nc1ccc([C@@H]2O[C@H](CN(C)[C@H](C)[C@@H](O)c3ccccc3)C[C@H](c3ccc(CO)cc3)O2)cc1 |
| InChI | InChI=1S/C36H47N3O6/c1-25(35(43)29-10-6-4-7-11-29)39(3)23-32-22-33(28-15-13-27(24-40)14-16-28)45-36(44-32)30-17-19-31(20-18-30)38-34(42)12-8-5-9-21-37-26(2)41/h4,6-7,10-11,13-20,25,32-33,35-36,40,43H,5,8-9,12,21-24H2,1-3H3,(H,37,41)(H,38,42)/t25-,32+,33-,35-,36-/m1/s1 |
| InChIKey | GXIJPQIDSJLRJM-WFNYLTINSA-N |
| XLogP | 5.41 |
| TPSA | 120.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.79 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|