C31H35Cl3N2O5 — CID 6696446
2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide (PubChem CID 6696446) has the molecular formula C31H35Cl3N2O5 and a molecular weight of 621.99 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 6696446 |
| Molecular Formula | C31H35Cl3N2O5 |
| Molecular Weight | 621.99 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | 2,2,2-trichloro-N-[[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[[(1S,2R)-1-hydroxy-1-phenylpropan-2-yl]-methylamino]methyl]-1,3-dioxan-2-yl]phenyl]methyl]acetamide |
| SMILES | C[C@H]([C@@H](O)c1ccccc1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(CNC(=O)C(Cl)(Cl)Cl)cc2)O1 |
| InChI | InChI=1S/C31H35Cl3N2O5/c1-20(28(38)24-6-4-3-5-7-24)36(2)18-26-16-27(23-12-10-22(19-37)11-13-23)41-29(40-26)25-14-8-21(9-15-25)17-35-30(39)31(32,33)34/h3-15,20,26-29,37-38H,16-19H2,1-2H3,(H,35,39)/t20-,26+,27-,28-,29-/m1/s1 |
| InChIKey | GSZOJYRDOOKJFJ-WFBROBLNSA-N |
| XLogP | 5.76 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|