C43H48N4O5 — CID 6678607
N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 6678607) has the molecular formula C43H48N4O5 and a molecular weight of 700.88 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 6678607 |
| Molecular Formula | C43H48N4O5 |
| Molecular Weight | 700.88 g/mol |
| Exact Mass | 700.36 |
| IUPAC Name | N'-(2-aminophenyl)-N-[4-[(2S,4R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[[methyl-[(1R)-1-naphthalen-2-ylethyl]amino]methyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | C[C@H](c1ccc2ccccc2c1)N(C)C[C@@H]1C[C@H](c2ccc(CO)cc2)O[C@H](c2ccc(NC(=O)CCCCC(=O)Nc3ccccc3N)cc2)O1 |
| InChI | InChI=1S/C43H48N4O5/c1-29(34-20-19-31-9-3-4-10-35(31)25-34)47(2)27-37-26-40(32-17-15-30(28-48)16-18-32)52-43(51-37)33-21-23-36(24-22-33)45-41(49)13-7-8-14-42(50)46-39-12-6-5-11-38(39)44/h3-6,9-12,15-25,29,37,40,43,48H,7-8,13-14,26-28,44H2,1-2H3,(H,45,49)(H,46,50)/t29-,37+,40-,43-/m1/s1 |
| InChIKey | USEDIHOISQEEHQ-UCYFXZJJSA-N |
| XLogP | 8.29 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.88 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|