C39H46N4O7 — CID 3539069
N'-(2-aminophenyl)-N-[3-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide (PubChem CID 3539069) has the molecular formula C39H46N4O7 and a molecular weight of 682.82 g/mol. Its IUPAC name is N'-(2-aminophenyl)-N-[3-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide.
| Compound Name | N'-(2-aminophenyl)-N-[3-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
|---|---|
| PubChem CID | 3539069 |
| Molecular Formula | C39H46N4O7 |
| Molecular Weight | 682.82 g/mol |
| Exact Mass | 682.34 |
| IUPAC Name | N'-(2-aminophenyl)-N-[3-[4-[[[2-hydroxy-2-(3-hydroxyphenyl)ethyl]-methylamino]methyl]-6-[4-(hydroxymethyl)phenyl]-1,3-dioxan-2-yl]phenyl]hexanediamide |
| SMILES | CN(CC1CC(c2ccc(CO)cc2)OC(c2cccc(NC(=O)CCCCC(=O)Nc3ccccc3N)c2)O1)CC(O)c1cccc(O)c1 |
| InChI | InChI=1S/C39H46N4O7/c1-43(24-35(46)28-8-7-11-31(45)21-28)23-32-22-36(27-18-16-26(25-44)17-19-27)50-39(49-32)29-9-6-10-30(20-29)41-37(47)14-4-5-15-38(48)42-34-13-3-2-12-33(34)40/h2-3,6-13,16-21,32,35-36,39,44-46H,4-5,14-15,22-25,40H2,1H3,(H,41,47)(H,42,48) |
| InChIKey | YGDGVUNVKMEZDU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 166.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.82 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|