C26H32O5 — CID 11015412
ethyl (Z)-4-[(4S,6S)-2-phenyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]but-2-enoate (PubChem CID 11015412) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is ethyl (Z)-4-[(4S,6S)-2-phenyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]but-2-enoate.
| Compound Name | ethyl (Z)-4-[(4S,6S)-2-phenyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]but-2-enoate |
|---|---|
| PubChem CID | 11015412 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | ethyl (Z)-4-[(4S,6S)-2-phenyl-6-[(2S)-1-phenylmethoxypropan-2-yl]-1,3-dioxan-4-yl]but-2-enoate |
| SMILES | CCOC(=O)/C=C\C[C@H]1C[C@@H]([C@@H](C)COCc2ccccc2)OC(c2ccccc2)O1 |
| InChI | InChI=1S/C26H32O5/c1-3-29-25(27)16-10-15-23-17-24(31-26(30-23)22-13-8-5-9-14-22)20(2)18-28-19-21-11-6-4-7-12-21/h4-14,16,20,23-24,26H,3,15,17-19H2,1-2H3/b16-10-/t20-,23-,24-,26?/m0/s1 |
| InChIKey | XCKUGMBKTUJCLM-LGURDXLBSA-N |
| XLogP | 5.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|