C27H34O9S — CID 72711005
ethyl (2R,3R)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]-2-methylsulfonyloxypent-4-enoate (PubChem CID 72711005) has the molecular formula C27H34O9S and a molecular weight of 534.63 g/mol. Its IUPAC name is ethyl (2R,3R)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]-2-methylsulfonyloxypent-4-enoate.
| Compound Name | ethyl (2R,3R)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]-2-methylsulfonyloxypent-4-enoate |
|---|---|
| PubChem CID | 72711005 |
| Molecular Formula | C27H34O9S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | ethyl (2R,3R)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]-2-methylsulfonyloxypent-4-enoate |
| SMILES | C=C[C@H]([C@H]1C[C@@H](COCc2ccc(OC)cc2)O[C@@H](c2ccccc2)O1)[C@@H](OS(C)(=O)=O)C(=O)OCC |
| InChI | InChI=1S/C27H34O9S/c1-5-23(25(26(28)33-6-2)36-37(4,29)30)24-16-22(34-27(35-24)20-10-8-7-9-11-20)18-32-17-19-12-14-21(31-3)15-13-19/h5,7-15,22-25,27H,1,6,16-18H2,2-4H3/t22-,23+,24+,25+,27+/m0/s1 |
| InChIKey | AELGGVDBYZHRRK-JTCWXIJDSA-N |
| XLogP | 3.79 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|