C25H32O8S — CID 72711455
[(3S)-1-hydroxy-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-yl] methanesulfonate (PubChem CID 72711455) has the molecular formula C25H32O8S and a molecular weight of 492.59 g/mol. Its IUPAC name is [(3S)-1-hydroxy-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-yl] methanesulfonate.
| Compound Name | [(3S)-1-hydroxy-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-yl] methanesulfonate |
|---|---|
| PubChem CID | 72711455 |
| Molecular Formula | C25H32O8S |
| Molecular Weight | 492.59 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | [(3S)-1-hydroxy-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]pent-4-en-2-yl] methanesulfonate |
| SMILES | C=C[C@H](C(CO)OS(C)(=O)=O)[C@H]1C[C@@H](COCc2ccc(OC)cc2)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C25H32O8S/c1-4-22(24(15-26)33-34(3,27)28)23-14-21(31-25(32-23)19-8-6-5-7-9-19)17-30-16-18-10-12-20(29-2)13-11-18/h4-13,21-26H,1,14-17H2,2-3H3/t21-,22-,23+,24?,25+/m0/s1 |
| InChIKey | DJESVFLSEPSKOG-JZGJKWFZSA-N |
| XLogP | 3.22 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|