C24H28O6 — CID 72711234
ethyl (E)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate (PubChem CID 72711234) has the molecular formula C24H28O6 and a molecular weight of 412.48 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 72711234 |
| Molecular Formula | C24H28O6 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | ethyl (E)-3-[(2S,4R,6S)-6-[(4-methoxyphenyl)methoxymethyl]-2-phenyl-1,3-dioxan-4-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H]1C[C@@H](COCc2ccc(OC)cc2)O[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C24H28O6/c1-3-28-23(25)14-13-21-15-22(30-24(29-21)19-7-5-4-6-8-19)17-27-16-18-9-11-20(26-2)12-10-18/h4-14,21-22,24H,3,15-17H2,1-2H3/b14-13+/t21-,22-,24-/m0/s1 |
| InChIKey | LMZRFZGMZLMEFC-WEFJHDNDSA-N |
| XLogP | 4.20 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|