C28H27NO5 — CID 102341028
ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2,4-diphenylpyrrolidin-3-yl]prop-2-enoate (PubChem CID 102341028) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2,4-diphenylpyrrolidin-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2,4-diphenylpyrrolidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102341028 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-1-(4-methoxyphenyl)-5-oxo-2,4-diphenylpyrrolidin-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](c2ccccc2)N(c2ccc(OC)cc2)C(=O)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C28H27NO5/c1-3-34-25(30)19-18-24-26(20-10-6-4-7-11-20)29(22-14-16-23(33-2)17-15-22)27(31)28(24,32)21-12-8-5-9-13-21/h4-19,24,26,32H,3H2,1-2H3/b19-18+/t24-,26-,28+/m1/s1 |
| InChIKey | JCRADGRPZASZHQ-QXMWYICMSA-N |
| XLogP | 4.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|