C27H25NO4 — CID 102341017
ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-5-oxo-1,2,4-triphenylpyrrolidin-3-yl]prop-2-enoate (PubChem CID 102341017) has the molecular formula C27H25NO4 and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-5-oxo-1,2,4-triphenylpyrrolidin-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-5-oxo-1,2,4-triphenylpyrrolidin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 102341017 |
| Molecular Formula | C27H25NO4 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | ethyl (E)-3-[(2S,3R,4R)-4-hydroxy-5-oxo-1,2,4-triphenylpyrrolidin-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](c2ccccc2)N(c2ccccc2)C(=O)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C27H25NO4/c1-2-32-24(29)19-18-23-25(20-12-6-3-7-13-20)28(22-16-10-5-11-17-22)26(30)27(23,31)21-14-8-4-9-15-21/h3-19,23,25,31H,2H2,1H3/b19-18+/t23-,25-,27+/m1/s1 |
| InChIKey | DKWMNBJRPLAKCT-MYFDSWCGSA-N |
| XLogP | 4.40 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|