C21H21ClN2O3 — CID 70575023
ethyl 3-[[(3R,4S)-1-(4-chlorophenyl)-2-oxo-4-phenylazetidin-3-yl]amino]but-2-enoate (PubChem CID 70575023) has the molecular formula C21H21ClN2O3 and a molecular weight of 384.86 g/mol. Its IUPAC name is ethyl 3-[[(3R,4S)-1-(4-chlorophenyl)-2-oxo-4-phenylazetidin-3-yl]amino]but-2-enoate.
| Compound Name | ethyl 3-[[(3R,4S)-1-(4-chlorophenyl)-2-oxo-4-phenylazetidin-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 70575023 |
| Molecular Formula | C21H21ClN2O3 |
| Molecular Weight | 384.86 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | ethyl 3-[[(3R,4S)-1-(4-chlorophenyl)-2-oxo-4-phenylazetidin-3-yl]amino]but-2-enoate |
| SMILES | CCOC(=O)C=C(C)N[C@H]1C(=O)N(c2ccc(Cl)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H21ClN2O3/c1-3-27-18(25)13-14(2)23-19-20(15-7-5-4-6-8-15)24(21(19)26)17-11-9-16(22)10-12-17/h4-13,19-20,23H,3H2,1-2H3/t19-,20+/m1/s1 |
| InChIKey | WSCSLACZRYCFMC-UXHICEINSA-N |
| XLogP | 3.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|