C20H20N2O3 — CID 70577054
methyl 3-[[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]amino]but-2-enoate (PubChem CID 70577054) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is methyl 3-[[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]amino]but-2-enoate.
| Compound Name | methyl 3-[[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 70577054 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | methyl 3-[[(3R,4S)-2-oxo-1,4-diphenylazetidin-3-yl]amino]but-2-enoate |
| SMILES | COC(=O)C=C(C)N[C@H]1C(=O)N(c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H20N2O3/c1-14(13-17(23)25-2)21-18-19(15-9-5-3-6-10-15)22(20(18)24)16-11-7-4-8-12-16/h3-13,18-19,21H,1-2H3/t18-,19+/m1/s1 |
| InChIKey | DQOWRLULCFZIOA-MOPGFXCFSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|