C28H28N2O4 — CID 70576719
methyl 3-[[(2S,3R)-1-benzhydryl-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate (PubChem CID 70576719) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is methyl 3-[[(2S,3R)-1-benzhydryl-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate.
| Compound Name | methyl 3-[[(2S,3R)-1-benzhydryl-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 70576719 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | methyl 3-[[(2S,3R)-1-benzhydryl-2-(4-methoxyphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate |
| SMILES | COC(=O)C=C(C)N[C@H]1C(=O)N(C(c2ccccc2)c2ccccc2)[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C28H28N2O4/c1-19(18-24(31)34-3)29-25-27(22-14-16-23(33-2)17-15-22)30(28(25)32)26(20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-18,25-27,29H,1-3H3/t25-,27+/m1/s1 |
| InChIKey | MLBKQIJBNSYYTL-VPUSJEBWSA-N |
| XLogP | 4.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|