C22H24N2O4 — CID 13331759
methyl (Z)-3-[[(2R,3S)-2-(4-methoxyphenyl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate (PubChem CID 13331759) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl (Z)-3-[[(2R,3S)-2-(4-methoxyphenyl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate.
| Compound Name | methyl (Z)-3-[[(2R,3S)-2-(4-methoxyphenyl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 13331759 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl (Z)-3-[[(2R,3S)-2-(4-methoxyphenyl)-1-(4-methylphenyl)-4-oxoazetidin-3-yl]amino]but-2-enoate |
| SMILES | COC(=O)/C=C(/C)N[C@@H]1C(=O)N(c2ccc(C)cc2)[C@@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-14-5-9-17(10-6-14)24-21(16-7-11-18(27-3)12-8-16)20(22(24)26)23-15(2)13-19(25)28-4/h5-13,20-21,23H,1-4H3/b15-13-/t20-,21+/m0/s1 |
| InChIKey | ARHGJDYNWNFSBB-UCWKNAMGSA-N |
| XLogP | 3.13 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|