C26H32N2O2 — CID 11338663
ethyl (E)-5-[(4S,5S)-2-ethenyl-1,3-dimethyl-4,5-diphenylimidazolidin-2-yl]pent-2-enoate (PubChem CID 11338663) has the molecular formula C26H32N2O2 and a molecular weight of 404.55 g/mol. Its IUPAC name is ethyl (E)-5-[(4S,5S)-2-ethenyl-1,3-dimethyl-4,5-diphenylimidazolidin-2-yl]pent-2-enoate.
| Compound Name | ethyl (E)-5-[(4S,5S)-2-ethenyl-1,3-dimethyl-4,5-diphenylimidazolidin-2-yl]pent-2-enoate |
|---|---|
| PubChem CID | 11338663 |
| Molecular Formula | C26H32N2O2 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.25 |
| IUPAC Name | ethyl (E)-5-[(4S,5S)-2-ethenyl-1,3-dimethyl-4,5-diphenylimidazolidin-2-yl]pent-2-enoate |
| SMILES | C=CC1(CC/C=C/C(=O)OCC)N(C)[C@@H](c2ccccc2)[C@H](c2ccccc2)N1C |
| InChI | InChI=1S/C26H32N2O2/c1-5-26(20-14-13-19-23(29)30-6-2)27(3)24(21-15-9-7-10-16-21)25(28(26)4)22-17-11-8-12-18-22/h5,7-13,15-19,24-25H,1,6,14,20H2,2-4H3/b19-13+/t24-,25-/m0/s1 |
| InChIKey | KYIRRBJAJGMSSP-OBKMITBJSA-N |
| XLogP | 5.13 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|