C34H29NO3 — CID 177407711
ethyl (Z)-3-[(4S)-6-oxo-1,4,5,5-tetraphenyl-4H-pyridin-2-yl]prop-2-enoate (PubChem CID 177407711) has the molecular formula C34H29NO3 and a molecular weight of 499.61 g/mol. Its IUPAC name is ethyl (Z)-3-[(4S)-6-oxo-1,4,5,5-tetraphenyl-4H-pyridin-2-yl]prop-2-enoate.
| Compound Name | ethyl (Z)-3-[(4S)-6-oxo-1,4,5,5-tetraphenyl-4H-pyridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 177407711 |
| Molecular Formula | C34H29NO3 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | ethyl (Z)-3-[(4S)-6-oxo-1,4,5,5-tetraphenyl-4H-pyridin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C\C1=C[C@@H](c2ccccc2)C(c2ccccc2)(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C34H29NO3/c1-2-38-32(36)24-23-30-25-31(26-15-7-3-8-16-26)34(27-17-9-4-10-18-27,28-19-11-5-12-20-28)33(37)35(30)29-21-13-6-14-22-29/h3-25,31H,2H2,1H3/b24-23-/t31-/m0/s1 |
| InChIKey | HVCMHYXTQUNPTG-YDGFMLSUSA-N |
| XLogP | 6.81 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|