C16H18N2O4 — CID 15371571
ethyl (E)-3-(1-acetyl-2-methyl-4-oxo-3-phenyl-1,3-diazetidin-2-yl)prop-2-enoate (PubChem CID 15371571) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is ethyl (E)-3-(1-acetyl-2-methyl-4-oxo-3-phenyl-1,3-diazetidin-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-(1-acetyl-2-methyl-4-oxo-3-phenyl-1,3-diazetidin-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 15371571 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | ethyl (E)-3-(1-acetyl-2-methyl-4-oxo-3-phenyl-1,3-diazetidin-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1(C)N(C(C)=O)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C16H18N2O4/c1-4-22-14(20)10-11-16(3)17(12(2)19)15(21)18(16)13-8-6-5-7-9-13/h5-11H,4H2,1-3H3/b11-10+ |
| InChIKey | CDLIOWGNNLJHKG-ZHACJKMWSA-N |
| XLogP | 2.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|