C34H34N2O6 — CID 102341026
tert-butyl 3-[(2S,3R,4R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-hydroxy-5-oxo-1,4-diphenylpyrrolidin-2-yl]indole-1-carboxylate (PubChem CID 102341026) has the molecular formula C34H34N2O6 and a molecular weight of 566.65 g/mol. Its IUPAC name is tert-butyl 3-[(2S,3R,4R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-hydroxy-5-oxo-1,4-diphenylpyrrolidin-2-yl]indole-1-carboxylate.
| Compound Name | tert-butyl 3-[(2S,3R,4R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-hydroxy-5-oxo-1,4-diphenylpyrrolidin-2-yl]indole-1-carboxylate |
|---|---|
| PubChem CID | 102341026 |
| Molecular Formula | C34H34N2O6 |
| Molecular Weight | 566.65 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | tert-butyl 3-[(2S,3R,4R)-3-[(E)-3-ethoxy-3-oxoprop-1-enyl]-4-hydroxy-5-oxo-1,4-diphenylpyrrolidin-2-yl]indole-1-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](c2cn(C(=O)OC(C)(C)C)c3ccccc23)N(c2ccccc2)C(=O)[C@]1(O)c1ccccc1 |
| InChI | InChI=1S/C34H34N2O6/c1-5-41-29(37)21-20-27-30(26-22-35(32(39)42-33(2,3)4)28-19-13-12-18-25(26)28)36(24-16-10-7-11-17-24)31(38)34(27,40)23-14-8-6-9-15-23/h6-22,27,30,40H,5H2,1-4H3/b21-20+/t27-,30-,34+/m1/s1 |
| InChIKey | XITZZJNVTUTUKL-KGOCXAMJSA-N |
| XLogP | 6.14 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.65 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|