C23H31NO6 — CID 56934615
tert-butyl (3aS,4S,6R,6aR)-6-[(Z)-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate (PubChem CID 56934615) has the molecular formula C23H31NO6 and a molecular weight of 417.50 g/mol. Its IUPAC name is tert-butyl (3aS,4S,6R,6aR)-6-[(Z)-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl (3aS,4S,6R,6aR)-6-[(Z)-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 56934615 |
| Molecular Formula | C23H31NO6 |
| Molecular Weight | 417.50 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | tert-butyl (3aS,4S,6R,6aR)-6-[(Z)-3-ethoxy-3-oxoprop-1-enyl]-2,2-dimethyl-4-phenyl-3a,4,6,6a-tetrahydro-[1,3]dioxolo[4,5-c]pyrrole-5-carboxylate |
| SMILES | CCOC(=O)/C=C\[C@@H]1[C@H]2OC(C)(C)O[C@H]2[C@H](c2ccccc2)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H31NO6/c1-7-27-17(25)14-13-16-19-20(29-23(5,6)28-19)18(15-11-9-8-10-12-15)24(16)21(26)30-22(2,3)4/h8-14,16,18-20H,7H2,1-6H3/b14-13-/t16-,18+,19-,20+/m1/s1 |
| InChIKey | JHIYEBUDUVQJIB-RBYMYVNSSA-N |
| XLogP | 3.99 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|