C19H25NO4 — CID 138966865
ethyl (E)-3-[1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridin-2-yl]prop-2-enoate (PubChem CID 138966865) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is ethyl (E)-3-[1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 138966865 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethyl (E)-3-[1-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]aziridin-2-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/C1C([C@H]2COC(C)(C)O2)N1Cc1ccccc1 |
| InChI | InChI=1S/C19H25NO4/c1-4-22-17(21)11-10-15-18(16-13-23-19(2,3)24-16)20(15)12-14-8-6-5-7-9-14/h5-11,15-16,18H,4,12-13H2,1-3H3/b11-10+/t15?,16-,18?,20?/m1/s1 |
| InChIKey | LEIMIGWJHBRFQU-RWAGUVQNSA-N |
| XLogP | 2.51 |
| TPSA | 47.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|