C26H31NO9 — CID 100995054
benzyl (E)-3-[(2R,3S)-1-[(2R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxy-2-oxoethyl)-2,5-dihydrofuran-3-yl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate (PubChem CID 100995054) has the molecular formula C26H31NO9 and a molecular weight of 501.53 g/mol. Its IUPAC name is benzyl (E)-3-[(2R,3S)-1-[(2R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxy-2-oxoethyl)-2,5-dihydrofuran-3-yl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate.
| Compound Name | benzyl (E)-3-[(2R,3S)-1-[(2R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxy-2-oxoethyl)-2,5-dihydrofuran-3-yl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 100995054 |
| Molecular Formula | C26H31NO9 |
| Molecular Weight | 501.53 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | benzyl (E)-3-[(2R,3S)-1-[(2R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(2-methoxy-2-oxoethyl)-2,5-dihydrofuran-3-yl]-3-methoxy-4-oxoazetidin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C[C@H]1O[C@@H]([C@H]2COC(C)(C)O2)C=C1N1C(=O)[C@@H](OC)[C@H]1/C=C/C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H31NO9/c1-26(2)34-15-21(36-26)20-12-18(19(35-20)13-23(29)31-3)27-17(24(32-4)25(27)30)10-11-22(28)33-14-16-8-6-5-7-9-16/h5-12,17,19-21,24H,13-15H2,1-4H3/b11-10+/t17-,19-,20-,21-,24+/m1/s1 |
| InChIKey | RPTSYFCGYHNROO-NMDNYHRBSA-N |
| XLogP | 1.88 |
| TPSA | 109.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|