C22H29NO4 — CID 11845705
benzyl N-[(1R,6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]carbamate (PubChem CID 11845705) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is benzyl N-[(1R,6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]carbamate.
| Compound Name | benzyl N-[(1R,6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]carbamate |
|---|---|
| PubChem CID | 11845705 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | benzyl N-[(1R,6S)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]carbamate |
| SMILES | C=C[C@]1(NC(=O)OCc2ccccc2)CC=C(C)C[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H29NO4/c1-5-22(23-20(24)25-14-17-9-7-6-8-10-17)12-11-16(2)13-18(22)19-15-26-21(3,4)27-19/h5-11,18-19H,1,12-15H2,2-4H3,(H,23,24)/t18-,19-,22+/m1/s1 |
| InChIKey | YBTOXYYIRIVUOR-KNKQGSTJSA-N |
| XLogP | 4.35 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|