C22H26Cl3NO6 — CID 11038485
2,2,2-trichloro-N-[(1R,2S,3R,4S,6S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-formyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide (PubChem CID 11038485) has the molecular formula C22H26Cl3NO6 and a molecular weight of 506.81 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R,2S,3R,4S,6S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-formyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R,2S,3R,4S,6S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-formyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide |
|---|---|
| PubChem CID | 11038485 |
| Molecular Formula | C22H26Cl3NO6 |
| Molecular Weight | 506.81 g/mol |
| Exact Mass | 505.08 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R,2S,3R,4S,6S)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-formyl-6-methyl-2-phenylmethoxy-7-oxabicyclo[4.1.0]heptan-3-yl]acetamide |
| SMILES | CC1(C)OC[C@H]([C@H]2C[C@]3(C)O[C@@H]3[C@@H](OCc3ccccc3)[C@]2(C=O)NC(=O)C(Cl)(Cl)Cl)O1 |
| InChI | InChI=1S/C22H26Cl3NO6/c1-19(2)30-11-15(31-19)14-9-20(3)16(32-20)17(29-10-13-7-5-4-6-8-13)21(14,12-27)26-18(28)22(23,24)25/h4-8,12,14-17H,9-11H2,1-3H3,(H,26,28)/t14-,15-,16-,17-,20+,21-/m1/s1 |
| InChIKey | KVPBIDASZMBQKZ-YLMHJTNXSA-N |
| XLogP | 3.32 |
| TPSA | 86.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.81 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|