C22H36Cl3NO4Si — CID 10768102
N-[(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]-2,2,2-trichloroacetamide (PubChem CID 10768102) has the molecular formula C22H36Cl3NO4Si and a molecular weight of 512.98 g/mol. Its IUPAC name is N-[(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]-2,2,2-trichloroacetamide.
| Compound Name | N-[(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]-2,2,2-trichloroacetamide |
|---|---|
| PubChem CID | 10768102 |
| Molecular Formula | C22H36Cl3NO4Si |
| Molecular Weight | 512.98 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | N-[(1R,2S,6S)-2-[tert-butyl(dimethyl)silyl]oxy-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-methylcyclohex-3-en-1-yl]-2,2,2-trichloroacetamide |
| SMILES | C=C[C@]1(NC(=O)C(Cl)(Cl)Cl)[C@@H](O[Si](C)(C)C(C)(C)C)C=C(C)C[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C22H36Cl3NO4Si/c1-10-21(26-18(27)22(23,24)25)15(16-13-28-20(6,7)29-16)11-14(2)12-17(21)30-31(8,9)19(3,4)5/h10,12,15-17H,1,11,13H2,2-9H3,(H,26,27)/t15-,16-,17+,21-/m1/s1 |
| InChIKey | YBUZHFHFPXMPHW-PZTGFMGMSA-N |
| XLogP | 5.91 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.98 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|