C16H22Br2Cl3NO4 — CID 134832797
2,2,2-trichloro-N-[(1R,4R,5S)-4,5-dibromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-(hydroxymethyl)cyclohexyl]acetamide (PubChem CID 134832797) has the molecular formula C16H22Br2Cl3NO4 and a molecular weight of 558.52 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R,4R,5S)-4,5-dibromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-(hydroxymethyl)cyclohexyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R,4R,5S)-4,5-dibromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-(hydroxymethyl)cyclohexyl]acetamide |
|---|---|
| PubChem CID | 134832797 |
| Molecular Formula | C16H22Br2Cl3NO4 |
| Molecular Weight | 558.52 g/mol |
| Exact Mass | 554.90 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R,4R,5S)-4,5-dibromo-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-ethenyl-4-(hydroxymethyl)cyclohexyl]acetamide |
| SMILES | C=C[C@]1(NC(=O)C(Cl)(Cl)Cl)C[C@H](Br)[C@](Br)(CO)CC1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C16H22Br2Cl3NO4/c1-4-15(22-12(24)16(19,20)21)6-11(17)14(18,8-23)5-9(15)10-7-25-13(2,3)26-10/h4,9-11,23H,1,5-8H2,2-3H3,(H,22,24)/t9?,10-,11+,14-,15+/m1/s1 |
| InChIKey | MKHNLTVLOAZWEY-VSUSGERISA-N |
| XLogP | 3.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|