C15H20N2O7 — CID 70408427
2-[[[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-1-prop-2-enylazetidin-3-yl]amino]methylidene]propanedioic acid (PubChem CID 70408427) has the molecular formula C15H20N2O7 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-[[[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-1-prop-2-enylazetidin-3-yl]amino]methylidene]propanedioic acid.
| Compound Name | 2-[[[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-1-prop-2-enylazetidin-3-yl]amino]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 70408427 |
| Molecular Formula | C15H20N2O7 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 2-[[[(2S,3S)-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-oxo-1-prop-2-enylazetidin-3-yl]amino]methylidene]propanedioic acid |
| SMILES | C=CCN1C(=O)[C@@H](NC=C(C(=O)O)C(=O)O)[C@H]1[C@@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C15H20N2O7/c1-4-5-17-11(9-7-23-15(2,3)24-9)10(12(17)18)16-6-8(13(19)20)14(21)22/h4,6,9-11,16H,1,5,7H2,2-3H3,(H,19,20)(H,21,22)/t9-,10-,11+/m0/s1 |
| InChIKey | SAEUIHRZHIEEQK-GARJFASQSA-N |
| XLogP | -0.45 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|